CAS 132951-61-2
:(4-fluorophenyl)-alpha-methyl-5-benzoxazole methylamine
Description:
(4-Fluorophenyl)-alpha-methyl-5-benzoxazole methylamine, identified by its CAS number 132951-61-2, is a chemical compound that features a benzoxazole core, which is a bicyclic structure containing both benzene and oxazole rings. The presence of a fluorine atom at the para position of the phenyl group contributes to its electronic properties, potentially influencing its reactivity and interaction with biological targets. The alpha-methyl group enhances steric hindrance, which may affect the compound's binding affinity and selectivity in pharmacological applications. Methylamine functionality introduces basic properties, allowing for potential interactions with acidic sites in biological systems. This compound may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions, although specific biological activities would require empirical investigation. As with many compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H13FN2O
InChI:InChI=1/C15H13FN2O/c1-2-17-12-7-8-14-13(9-12)18-15(19-14)10-3-5-11(16)6-4-10/h3-9,17H,2H2,1H3
SMILES:CCNc1ccc2c(c1)nc(c1ccc(cc1)F)o2
Synonyms:- S-Flopa
- N-ethyl-2-(4-fluorophenyl)-1,3-benzoxazol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.