CymitQuimica logo

CAS 13296-76-9

:

Eleostearic acid

Description:
Eleostearic acid is a conjugated fatty acid primarily derived from the seeds of certain plants, notably the tung tree (Vernicia fordii) and some varieties of evening primrose. It is characterized by its unique structure, which includes multiple double bonds in a conjugated arrangement, specifically three double bonds in a cis configuration. This structure imparts distinct physical and chemical properties, such as a lower melting point compared to saturated fatty acids, making it liquid at room temperature. Eleostearic acid is known for its potential health benefits, including anti-inflammatory and antioxidant properties, and is often studied for its role in various biological processes. Additionally, it is utilized in the production of drying oils and coatings due to its ability to polymerize upon exposure to air. The compound is also of interest in the field of biochemistry and nutrition, where it may influence lipid metabolism and cellular functions. Overall, eleostearic acid is a significant fatty acid with diverse applications and health implications.
Formula:C18H30O2
InChI:InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-10H,2-4,11-17H2,1H3,(H,19,20)
InChI key:InChIKey=CUXYLFPMQMFGPL-UHFFFAOYSA-N
SMILES:C(CC=CC=CC=CCCCC)CCCCCC(O)=O
Synonyms:
  • NSC 407903
  • Elaeostearic acid
  • Eleostearic acid
  • 9,11,13-Octadecatrienoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.