CymitQuimica logo

CAS 132960-14-6

:

N-Methoxy-2,N-dimethylacrylamide

Description:
N-Methoxy-2,N-dimethylacrylamide is an organic compound characterized by its acrylamide structure, which includes a methoxy group and two dimethyl groups attached to the nitrogen atom. This compound typically appears as a colorless to pale yellow liquid and is soluble in polar solvents such as water and alcohols due to the presence of the methoxy group. It is known for its ability to participate in polymerization reactions, making it useful in the synthesis of various polymers and copolymers. The presence of the acrylamide functional group allows for reactivity under certain conditions, such as exposure to heat or UV light, leading to cross-linking and the formation of hydrogels. N-Methoxy-2,N-dimethylacrylamide is also of interest in the field of materials science and biochemistry, particularly in applications involving drug delivery systems and tissue engineering. However, like many acrylamide derivatives, it should be handled with care due to potential toxicity and environmental concerns associated with its use.
Formula:C6H11NO2
InChI:InChI=1/C6H11NO2/c1-5(2)6(8)7(3)9-4/h1H2,2-4H3
SMILES:C=C(C)C(=O)N(C)OC
Synonyms:
  • N-Methoxy-N,2-dimethyl-2-propenamide
  • N-methoxy-N,2-dimethylprop-2-enamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.