CAS 1329672-94-7

4-Piperidinamine, 1-[6-(trifluoromethyl)-4-pyrimidinyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-[6-(trifluoromethyl)-4-pyrimidinyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and pyrimidine moieties, which contribute to its biological activity. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in pharmaceutical formulations. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutics targeting various diseases. Its structure suggests potential applications in areas such as anti-infectives or other therapeutic agents, although specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed due to the presence of the trifluoromethyl group, which can impart unique reactivity and toxicity profiles. Overall, the compound's characteristics make it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₁₀H₁₃F₃N₄·2ClH

InChI: InChI=1S/C10H13F3N4.2ClH/c11-10(12,13)8-5-9(16-6-15-8)17-3-1-7(14)2-4-17;;/h5-7H,1-4,14H2;2*1H

InChI key: InChIKey=HTZFLWQPDKTQGG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(=NC=N1)N2CCC(N)CC2.Cl

Synonyms:

• 4-Piperidinamine, 1-[6-(trifluoromethyl)-4-pyrimidinyl]-, hydrochloride (1:2)

1-[6-(Trifluoromethyl)pyrimidin-4-yl]piperidin-4-amine dihydrochloride

CAS: 1329672-94-7

1-[6-(Trifluoromethyl)pyrimidin-4-yl]piperidin-4-amine dihydrochloride

Purity: ≥95%

Molecular weight: 319.15g/mol

Ref: 54-PC403088

1-[6-(Trifluoromethyl)pyrimidin-4-yl]piperidin-4-amine dihydrochloride

CAS: 1329672-94-7

Formula: C₁₀H₁₅Cl₂F₃N₄

Molecular weight: 319.15

Ref: 10-F097433