CAS 1329673-46-2

4-Piperidinamine, 1-(3-methyl-1,2,4-thiadiazol-5-yl)-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-(3-methyl-1,2,4-thiadiazol-5-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and thiadiazole moieties, which contribute to its biological activity. The piperidine ring provides a basic nitrogen atom, making the compound potentially soluble in polar solvents, while the thiadiazole ring introduces heteroatoms that can participate in various chemical interactions. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions, mechanisms of action, and potential applications would depend on further studies, including in vitro and in vivo evaluations. Safety and handling considerations are essential, as with any chemical substance, particularly those with biological activity. Proper laboratory protocols should be followed when working with this compound to ensure safety and compliance with regulatory standards.

Formula: C₈H₁₄N₄S·2ClH

InChI: InChI=1S/C8H14N4S.2ClH/c1-6-10-8(13-11-6)12-4-2-7(9)3-5-12;;/h7H,2-5,9H2,1H3;2*1H

InChI key: InChIKey=MDSALHUGABSVRL-UHFFFAOYSA-N

SMILES: CC=1N=C(N2CCC(N)CC2)SN1.Cl

Synonyms:

• 1-(3-Methyl-1,2,4-thiadiazol-5-yl)piperidin-4-amine dihydrochloride
• 4-Piperidinamine, 1-(3-methyl-1,2,4-thiadiazol-5-yl)-, hydrochloride (1:2)