
CAS 132971-59-6
:8-Hydroxy-3-(hydroxymethyl)-6-methoxy-1H-2-benzopyran-1-one
Description:
8-Hydroxy-3-(hydroxymethyl)-6-methoxy-1H-2-benzopyran-1-one, with the CAS number 132971-59-6, is a chemical compound belonging to the class of flavonoids, specifically a type of chromone. This compound features a benzopyran structure, which is characterized by a fused benzene and pyran ring. The presence of hydroxyl (-OH) and methoxy (-OCH3) groups contributes to its potential biological activity, including antioxidant properties. The hydroxymethyl group enhances its solubility and reactivity. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry and natural product research. Its structural characteristics suggest potential applications in the development of therapeutic agents, particularly in the fields of anti-inflammatory and anticancer research. Additionally, the presence of multiple functional groups allows for further chemical modifications, which can lead to the synthesis of derivatives with enhanced efficacy or selectivity. Overall, 8-Hydroxy-3-(hydroxymethyl)-6-methoxy-1H-2-benzopyran-1-one represents a valuable compound for further investigation in both synthetic and biological contexts.
Formula:C11H10O5
InChI:InChI=1S/C11H10O5/c1-15-7-2-6-3-8(5-12)16-11(14)10(6)9(13)4-7/h2-4,12-13H,5H2,1H3
InChI key:InChIKey=CAWNOJXNAUEIGB-UHFFFAOYSA-N
SMILES:OC1=C2C(C=C(CO)OC2=O)=CC(OC)=C1
Synonyms:- 8-Hydroxy-3-(hydroxymethyl)-6-methoxy-1H-2-benzopyran-1-one
- 1H-2-Benzopyran-1-one, 8-hydroxy-3-(hydroxymethyl)-6-methoxy-
- Antibiotic MI 43-37F11
- Cytogenin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cytogenin
CAS:<p>Cytogenin, a coumarin derivative isolated from S.</p>Formula:C11H10O5Color and Shape:SolidMolecular weight:222.19
