CymitQuimica logo

CAS 1329748-53-9

:

1-[6-(Trifluoromethyl)-4-pyrimidinyl]-4-piperidinamine

Description:
1-[6-(Trifluoromethyl)-4-pyrimidinyl]-4-piperidinamine, identified by its CAS number 1329748-53-9, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with a trifluoromethyl group and a piperidine moiety. This compound typically exhibits properties associated with both heterocyclic and amine functionalities, making it of interest in medicinal chemistry and pharmaceutical research. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, potentially affecting its interaction with biological targets. The presence of the piperidine ring contributes to its basicity and can facilitate binding to various receptors or enzymes. Additionally, the compound may exhibit specific solubility characteristics in organic solvents and water, depending on the overall molecular structure. Its potential applications could include roles as a pharmaceutical agent, particularly in the development of treatments for various diseases, although specific biological activities would require further investigation through experimental studies.
Formula:C10H13F3N4
InChI:InChI=1S/C10H13F3N4/c11-10(12,13)8-5-9(16-6-15-8)17-3-1-7(14)2-4-17/h5-7H,1-4,14H2
InChI key:InChIKey=ITOLHNGQPYSZJE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(=NC=N1)N2CCC(N)CC2
Synonyms:
  • 4-Piperidinamine, 1-[6-(trifluoromethyl)-4-pyrimidinyl]-
  • 1-[6-(Trifluoromethyl)-4-pyrimidinyl]-4-piperidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.