CAS 13299-21-3
:6-O-α-D-Galactopyranosyl-β-D-glucopyranose
Description:
6-O-α-D-Galactopyranosyl-β-D-glucopyranose, also known as galactosyl-glucose, is a disaccharide composed of two monosaccharides: galactose and glucose. This compound features a glycosidic bond between the 6-position of the galactose and the 1-position of the glucose, resulting in a specific stereochemistry that influences its biological activity and solubility. It is typically found in various natural sources, including certain polysaccharides and glycoproteins, and plays a role in cellular recognition processes. The compound is soluble in water due to its hydroxyl groups, which can form hydrogen bonds with water molecules. Its structural characteristics contribute to its functionality in biological systems, such as serving as a substrate for enzymes or participating in cell signaling pathways. Additionally, it may exhibit prebiotic properties, promoting the growth of beneficial gut bacteria. Overall, 6-O-α-D-Galactopyranosyl-β-D-glucopyranose is significant in both food science and biochemistry, highlighting its relevance in nutrition and health.
Formula:C12H22O11
InChI:InChI=1S/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5+,6-,7+,8+,9-,10-,11-,12+/m1/s1
InChI key:InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N
SMILES:O(C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)O1)[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O
Synonyms:- Melibiose, β-
- β-D-Glucopyranose, 6-O-α-D-galactopyranosyl-
- β-Melibiose
- 6-O-α-D-Galactopyranosyl-β-D-glucopyranose
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
