CAS 13299-97-3
:α-Hydroxy-α-methyl-γ-oxobenzenebutanoic acid
Description:
α-Hydroxy-α-methyl-γ-oxobenzenebutanoic acid, commonly referred to as a type of hydroxy acid, is characterized by its structural features that include a hydroxyl group (-OH), a methyl group, and a ketone functional group within a benzenebutanoic acid framework. This compound typically exhibits properties associated with both acids and alcohols, making it a versatile molecule in various chemical reactions. It is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or other fine chemicals. The presence of the aromatic benzene ring contributes to its stability and potential for engaging in electrophilic aromatic substitution reactions. Additionally, the α-hydroxy and α-methyl groups can influence its solubility and reactivity, making it of interest in both research and industrial applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c1-11(15,10(13)14)7-9(12)8-5-3-2-4-6-8/h2-6,15H,7H2,1H3,(H,13,14)
InChI key:InChIKey=KLQDKKWLFNZONJ-UHFFFAOYSA-N
SMILES:C(CC(C(O)=O)(C)O)(=O)C1=CC=CC=C1
Synonyms:- Benzenebutanoic acid, α-hydroxy-α-methyl-γ-oxo-
- Lactic acid, 3-benzoyl-2-methyl-
- α-Hydroxy-α-methyl-γ-oxobenzenebutanoic acid
- 2-Hydroxy-2-methyl-4-oxo-4-phenylbutanoic acid
- α-Methyl-β-benzoyllactic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
