CAS 132992-28-0
:2,3,5-Trifluorophenylacetic acid
Description:
2,3,5-Trifluorophenylacetic acid is an organic compound characterized by the presence of a phenyl ring substituted with three fluorine atoms at the 2, 3, and 5 positions, along with an acetic acid functional group. This compound is notable for its fluorinated structure, which can significantly influence its chemical reactivity, polarity, and biological activity. The trifluoromethyl groups enhance the lipophilicity and can affect the compound's interaction with biological targets, making it of interest in pharmaceutical research. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the carboxylic acid group allows for potential hydrogen bonding and reactivity in various chemical reactions, including esterification and amidation. Additionally, the trifluoromethyl substituents can impart unique properties, such as increased metabolic stability and altered pharmacokinetics. Overall, 2,3,5-Trifluorophenylacetic acid is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its distinctive structural features and potential applications.
Formula:C8H5F3O2
InChI:InChI=1/C8H5F3O2/c9-5-1-4(2-7(12)13)8(11)6(10)3-5/h1,3H,2H2,(H,12,13)
SMILES:c1c(CC(=O)O)c(c(cc1F)F)F
Synonyms:- 2,3,5-(Trifluorophenyl)Acetic Acid
- Rarechem Al Bo 0711
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzeneacetic acid, 2,3,5-trifluoro-
CAS:Formula:C8H5F3O2Purity:98%Color and Shape:SolidMolecular weight:190.11932,3,5-Trifluorophenylacetic acid
CAS:2,3,5-Trifluorophenylacetic acidFormula:C8H5F3O2Purity:98%Color and Shape: white crystalline powderMolecular weight:190.12g/mol2,3,5-Trifluorophenylacetic acid
CAS:Formula:C8H5F3O2Purity:97%Color and Shape:SolidMolecular weight:190.1212,3,5-Trifluorophenylacetic acid
CAS:Please enquire for more information about 2,3,5-Trifluorophenylacetic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C8H5F3O2Purity:Min. 95%Molecular weight:190.12 g/molRef: 3D-FT80547
Discontinued product





