CAS 133-03-9
:EPISESAMIN
Description:
Episesamin, with the CAS number 133-03-9, is a natural compound classified as a lignan, which is primarily found in sesame seeds. It is known for its potential health benefits, including antioxidant and anti-inflammatory properties. Structurally, episesamin is characterized by its complex polyphenolic framework, which contributes to its biological activity. This compound is often studied for its role in traditional medicine and its potential applications in nutraceuticals. Episesamin exhibits low solubility in water but is soluble in organic solvents, which is typical for many lignans. Its stability under various conditions makes it a subject of interest in food science and pharmacology. Additionally, episesamin has been investigated for its effects on lipid metabolism and its potential protective effects against certain diseases. Overall, episesamin represents a significant area of research due to its natural origin and promising health-related properties.
Formula:C20H18O6
InChI:InChI=1/C20H18O6/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19-,20+/m0/s1
Synonyms:- Ai 3-21202
- Ai3-21202
- 1,3-Benzodioxole, 5,5'-(tetrahydro-1H,3H-furo(3,4-c)furan-1,4-diyl)bis-, (+)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(+)-Episesamin
CAS:(+)-Episesamin is a bioactive compound known as a lignan, which is derived from the seeds of Sesame (Sesamum indicum). It exists as part of a complex mixture of lignans present in this plant, which are recognized for their potential biological activity. The mode of action of (+)-Episesamin involves antioxidant effects and modulation of lipid metabolism through pathways that may influence enzymes and receptors associated with these processes.
Formula:C20H18O6Purity:Min. 95%Molecular weight:354.4 g/mol
