CAS 133-09-5
:Benzoic acid, 4-amino-2-hydroxy-, potassium salt (1:1)
Description:
Benzoic acid, 4-amino-2-hydroxy-, potassium salt (1:1), commonly known as potassium 4-amino-2-hydroxybenzoate, is an organic compound characterized by its aromatic structure featuring a carboxylic acid group and an amino group. This compound is a potassium salt of 4-amino-2-hydroxybenzoic acid, which contributes to its solubility in water. It typically appears as a white to off-white crystalline powder. The presence of both amino and hydroxyl functional groups imparts various properties, including potential antioxidant activity and the ability to act as a pH buffer. This compound is often utilized in pharmaceuticals and as a food preservative due to its antimicrobial properties. Its CAS number, 133-09-5, is a unique identifier that facilitates the identification and regulation of this substance in chemical databases. Safety data indicates that while it is generally considered safe for use in food and pharmaceuticals, appropriate handling and storage practices should be observed to minimize any potential risks.
Formula:C7H7NO3·K
InChI:InChI=1S/C7H7NO3.K/c8-4-1-2-5(7(10)11)6(9)3-4;/h1-3,9H,8H2,(H,10,11);
InChI key:InChIKey=CDLODIXNTFPTEN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C=C(N)C=C1.[K]
Synonyms:- Salicylic acid, 4-amino-, monopotassium salt
- p-Aminosalicylic acid potassium salt
- Benzoic acid, 4-amino-2-hydroxy-, potassium salt (1:1)
- Benzoic acid, 4-amino-2-hydroxy-, monopotassium salt
- 4-Aminosalicylic acid potassium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
