CAS 133-21-1
:3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5-ol
Description:
3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5-ol, commonly known as isoborneol, is a bicyclic organic compound characterized by its unique structure that includes a bicyclo[3.3.0]octane framework. This compound features a hydroxyl (-OH) group, which contributes to its classification as an alcohol. Isoborneol is typically a colorless to pale yellow liquid with a camphor-like odor, making it useful in the fragrance and flavor industries. It is known for its potential applications in organic synthesis and as a chiral building block in pharmaceuticals. The compound is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. Additionally, isoborneol can exist in two enantiomeric forms, which can exhibit different biological activities. Its chemical stability and reactivity allow it to participate in various chemical reactions, including oxidation and reduction processes. Overall, isoborneol is a versatile compound with significant relevance in both industrial and research settings.
Formula:C10H14O
InChI:InChI=1S/C10H14O/c11-10-5-6-4-9(10)8-3-1-2-7(6)8/h1,3,6-11H,2,4-5H2
InChI key:InChIKey=LDUKQFUHJZHLRC-UHFFFAOYSA-N
SMILES:OC1C2C3C(C(C2)C1)CC=C3
Synonyms:- 3a,4,5,6,7,7a-Hexahydro-exo-4,7-methanoinden-5-ol
- 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-5-ol
- 4,7-Methano-1H-inden-5-ol, 3a,4,5,6,7,7a-hexahydro-
- 4,7-Methanoinden-5-ol, 3a,4,5,6,7,7a-hexahydro-
- 4,7-Methanoinden-5-ol, 3a,4,5,6,7,7a-hexahydro-, exo- (8CI)
- 5-Hydroxy-3a,4,5,6,7,7a-hexahydro-4,7-methanoindene
- Cydecanol
- Dicyclopentadiene alcohol
- Nsc 22463
- Tricyclo[5.2.1.0<sup>2,6</sup>]dec-4-en-8-ol
- Tricyclo[5.2.1.0<sup>2,6</sup>]decen-8-ol
- 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5-ol
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5-ol
CAS:Controlled ProductApplications 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-5-ol (cas# 133-21-1) is a useful research chemical.
Formula:C10H14OColor and Shape:NeatMolecular weight:150.218
