CAS 133-32-4: Indole-3-butyric acid
Description:Indole-3-butyric acid (IBA) is a naturally occurring plant hormone belonging to the auxin class, primarily involved in regulating plant growth and development. It is characterized by its structure, which includes an indole ring and a butyric acid side chain, contributing to its biological activity. IBA is known for promoting root formation in cuttings, making it a valuable compound in horticulture and agriculture for enhancing root development in various plant species. It is typically applied in rooting powders or solutions to stimulate adventitious root formation. IBA is soluble in organic solvents and exhibits limited solubility in water, which influences its application methods. Additionally, it is relatively stable under normal conditions but can degrade under extreme pH or light exposure. The compound's effectiveness can vary based on concentration and plant species, and it is often compared with other auxins like indole-3-acetic acid (IAA) in terms of rooting efficiency. Overall, IBA plays a crucial role in plant physiology and is widely utilized in propagation techniques.
Formula:C12H13NO2
InChI:InChI=1S/C12H13NO2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11/h1-2,5-6,8,13H,3-4,7H2,(H,14,15)
InChI key:InChIKey=JTEDVYBZBROSJT-UHFFFAOYSA-N
SMILES:O=C(O)CCCC1=CNC=2C=CC=CC21
- Synonyms:
- 1H-Indol-3-butanoic acid
- 1H-Indole-3-butyric acid
- 3-Carboxypropylindole
- 3-Indolebutyric acid
- 3-Indolyl-γ-butyric acid
- 3-Indolylbutyric acid
- 4-(1H-Indol-3-yl)butanoic acid
- 4-(1H-Indol-3-yl)butyric acid
- 4-(3-Indolyl)butanoic acid
- 4-(Indol-3-Yl)Butyric Acid
- See more synonyms
- 4-(Indol-3-yl)buttersaure
- 4-Indol-3-ylbutyric acid
- Acide 4-(Indole-3-Yl)Butyrique
- Acide 4-(indol-3-yl)butyrique
- Acido 4-(Indol-3-Il)Butirico
- Butanoic Acid, 3-Indole-
- Clonex
- Clonex (rooting hormone)
- Hormex
- Hormodin
- IBA
- Indole-3-butanoic acid
- Indole-3-butyric acid
- Indolebutyric acid
- Kornevin
- Nsc 3130
- Oxyberon
- Rootex
- Seradix
- Seradix 2
- Seradix 3
- Seradix B 2
- Seradix B 3
- Stim-Root
- [3-(3-Indolyl)propyl]carboxylic acid
- β-IBA
- β-Indolebutyric acid
- β-Indolylbutyric acid
- γ-(Indol-3-yl)butyric acid
- γ-(Indole-3)-butyric acid
- ω-(3-Indolyl)butyric acid
- 4-(1H-indol-3-yl)butanoate
- 1h-indole-3-butanoicacid
- 1H-Indole-3-butanoic acid
- Indol-3-butyric acid
- 3-Indole Butyric Acid
- Indole-3-butyric acid,[4-(3-Indolyl)butyric acid]
- 3-Indolebutyvic acid
- Naftidrofuryl
- 4-(3-Indolyl)butyric acid
- 4-(3-1H-Indolyl)butyric acid