CAS 133-38-0
:dihydroxyfumaric acid dihydrat
Description:
Dihydroxyfumaric acid dihydrate, with the CAS number 133-38-0, is an organic compound characterized by its structure, which features two hydroxyl (-OH) groups and a fumaric acid backbone. This compound typically appears as a white to off-white crystalline solid and is soluble in water, which is attributed to the presence of the hydroxyl groups that enhance its hydrophilicity. Dihydroxyfumaric acid dihydrate is known for its potential applications in various fields, including pharmaceuticals and biochemistry, due to its ability to participate in biochemical reactions and its role as a precursor in the synthesis of other organic compounds. The dihydrate form indicates that it contains two molecules of water for every molecule of the acid, which can influence its stability and reactivity. Additionally, it may exhibit antioxidant properties, making it of interest in research related to oxidative stress and related health conditions. Overall, its unique chemical properties and potential applications make it a compound of interest in both industrial and research settings.
Formula:C4H4O6
InChI:InChI=1/C4H4O6/c5-1(3(7)8)2(6)4(9)10/h5-6H,(H,7,8)(H,9,10)/b2-1+
InChI key:InChIKey=BZCOSCNPHJNQBP-OWOJBTEDSA-N
SMILES:C(=C(/C(O)=O)\O)(\C(O)=O)/O
Synonyms:- (2E)-2,3-Dihydroxy-2-butenedioic acid
- (2E)-2,3-dihydroxybut-2-enedioic acid
- 2,3-Dihydroxyfumaric acid
- 2-Butenedioic acid, 2,3-dihydroxy-, (2E)-
- 2-Butenedioic acid, 2,3-dihydroxy-, (E)-
- 3,4,4-Trihydroxy-2-Oxobut-3-Enoic Acid
- Dihydroxyfumaric acid
- Dihydroxyfumaric acid dihydrate
- Fumaric acid, dihydroxy-
- NSC 20941
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
