CAS 133-59-5: 2-Methylbenzenesulfonyl chloride

Description:2-Methylbenzenesulfonyl chloride, also known as toluenesulfonyl chloride, is an aromatic sulfonyl chloride characterized by the presence of a sulfonyl group (-SO2Cl) attached to a methyl-substituted benzene ring. This compound is typically a colorless to pale yellow liquid with a pungent odor. It is highly reactive, particularly with nucleophiles, making it a valuable reagent in organic synthesis for the introduction of sulfonyl groups into various substrates. The presence of the sulfonyl chloride functional group allows for the formation of sulfonamides and other derivatives through nucleophilic substitution reactions. Additionally, 2-Methylbenzenesulfonyl chloride is soluble in organic solvents such as dichloromethane and ether but reacts vigorously with water, releasing hydrochloric acid and forming the corresponding sulfonic acid. Due to its reactivity and potential hazards, including corrosiveness and toxicity, it should be handled with appropriate safety precautions in a well-ventilated environment.

Formula:C₇H₇ClO₂S

InChI:InChI=1S/C7H7ClO2S/c1-6-4-2-3-5-7(6)11(8,9)10/h2-5H,1H3

InChI key:InChIKey=HDECRAPHCDXMIJ-UHFFFAOYSA-N

SMILES:O=S(=O)(Cl)C=1C=CC=CC1C

Synonyms:
2-Methylbenzene-1-sulfonyl chloride
2-Methylbenzenesulfonyl Chloride
2-Methylphenylsulfonyl chloride
2-Toluenesulfonyl chloride
Benzenesulfonyl chloride, 2-methyl-
NSC 9354
o-Methylbenzenesulfonyl chloride
o-Toluenesulfonyl chloride
o-Toluenesulphonyl chloride
o-Tolylsulfonyl chloride
See more synonyms
o-Tosyl chloride

Found 5 products.

Product data	Purity	Price range	Estimated delivery
o-Toluenesulfonyl Chloride (contains ca. 23% isomer) REF: 3B-T0284CAS: 133-59-5	>75.0%(GC)	27.00 €~122.00 €	Thu 20 Mar 25
o-Toluenesulfonyl chloride, 80% REF: 02-L18983CAS: 133-59-5	80%	To inquire	Fri 21 Mar 25
2-Methylbenzenesulphonyl chloride REF: 54-OR9961CAS: 133-59-5	95%	143.00 €~323.00 €	Thu 03 Apr 25
2-Toluenesulfonyl chloride(contains ca.23% isomer) REF: 3D-FT164705CAS: 133-59-5	75%Min	136.00 €~546.00 €	Thu 08 May 25
2-Toluenesulfonyl chloride, 95% min GC REF: 3D-FT179490CAS: 133-59-5	Min. 95%	- - -	Discontinued product