
CAS 133-63-1
:2,2′-Methylenebis[6-(1,1-dimethylethyl)phenol]
Description:
2,2′-Methylenebis[6-(1,1-dimethylethyl)phenol], commonly known as MBP, is an organic compound characterized by its structure, which features two phenolic groups connected by a methylene bridge. This compound is recognized for its antioxidant properties, making it valuable in various industrial applications, particularly in the stabilization of polymers and plastics against oxidative degradation. MBP is typically a solid at room temperature and exhibits low solubility in water, while being more soluble in organic solvents. Its molecular structure contributes to its thermal stability and resistance to UV radiation, enhancing the longevity of materials in which it is incorporated. Additionally, MBP is often used in formulations to improve the performance and durability of products such as rubber, coatings, and adhesives. Safety data indicates that while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed to minimize exposure. Overall, MBP serves as an important additive in the field of materials science and polymer chemistry.
Formula:C21H28O2
InChI:InChI=1S/C21H28O2/c1-20(2,3)16-11-7-9-14(18(16)22)13-15-10-8-12-17(19(15)23)21(4,5)6/h7-12,22-23H,13H2,1-6H3
InChI key:InChIKey=PHAZIZJZLYBIIT-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(O)C(CC2=C(O)C(C(C)(C)C)=CC=C2)=CC=C1
Synonyms:- Seenox 224M
- 2,2′-Methylenebis[6-(1,1-dimethylethyl)phenol]
- Phenol, 2,2′-methylenebis[6-(1,1-dimethylethyl)-
- Phenol, 2,2′-methylenebis[6-tert-butyl-
- 2,2′-Methylenebis[6-tert-butylphenol]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
