
CAS 13300-09-9
:4-Methyl-6-phenyl-3(2H)-pyridazinone
Description:
4-Methyl-6-phenyl-3(2H)-pyridazinone, with the CAS number 13300-09-9, is a heterocyclic organic compound characterized by its pyridazinone structure, which includes a pyridazine ring fused with a carbonyl group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure features a methyl group and a phenyl group, which contribute to its chemical properties and potential reactivity. The presence of the pyridazinone moiety suggests that it may exhibit biological activity, making it of interest in medicinal chemistry. Additionally, compounds of this class can participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. The compound's stability and reactivity can be influenced by the substituents on the ring, which can affect its electronic properties. Overall, 4-Methyl-6-phenyl-3(2H)-pyridazinone is a compound of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C11H10N2O
InChI:InChI=1S/C11H10N2O/c1-8-7-10(12-13-11(8)14)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14)
InChI key:InChIKey=HNZITGUYCFHIMD-UHFFFAOYSA-N
SMILES:CC1=CC(=NNC1=O)C2=CC=CC=C2
Synonyms:- 4-Methyl-6-phenylpyridazin-3(2H)-one
- 4-Methyl-6-phenyl-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 4-methyl-6-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
