CAS 133001-07-7

4H-1,2,4-Triazole, 4-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl]-, cis-

Description:

4H-1,2,4-Triazole, 4-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl]-, cis- is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a complex substituent that includes a chlorophenyl and a fluorophenyl group, indicating the presence of halogen atoms that can influence its reactivity and biological activity. The oxirane (epoxide) moiety suggests potential for ring-opening reactions, which can be significant in various chemical processes. The cis- configuration implies specific stereochemistry that may affect the compound's interactions with biological targets. This substance is likely to exhibit properties typical of triazoles, such as antifungal activity, and may also possess unique characteristics due to its specific substituents. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, but detailed studies would be necessary to fully understand its behavior and efficacy in various contexts.

Formula: C₁₇H₁₃ClFN₃O

InChI: InChI=1/C17H13ClFN3O/c18-15-4-2-1-3-14(15)16-17(23-16,9-22-10-20-21-11-22)12-5-7-13(19)8-6-12/h1-8,10-11,16H,9H2/t16-,17-/s2

InChI key: InChIKey=QLCIKPCPKZMIAU-RXQGYGPJNA-N

SMILES: C([C@]1([C@H](O1)C2=C(Cl)C=CC=C2)C3=CC=C(F)C=C3)N4C=NN=C4

Synonyms:

• 4H-1,2,4-Triazole, 4-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl]-, cis-

Indoxacarb Impurity 3

CAS: 133001-07-7

Formula: C₁₇H₁₃ClFN₃O

Molecular weight: 329.76

Ref: 4Z-I-066004