CAS 133005-88-6
:cis-Stilbene-4,4'-dicarboxylic acid
Description:
Cis-Stilbene-4,4'-dicarboxylic acid is an organic compound characterized by its structure, which features a stilbene backbone with two carboxylic acid groups located at the para positions of the phenyl rings. This compound is typically a white to off-white crystalline solid and is known for its potential applications in organic synthesis and materials science, particularly in the development of polymers and as a building block for more complex molecules. The presence of the carboxylic acid groups contributes to its solubility in polar solvents and its ability to participate in various chemical reactions, such as esterification and amidation. Additionally, the cis configuration of the stilbene moiety influences its optical properties, making it of interest in studies related to photochemistry and photophysics. The compound's reactivity and functional groups also suggest potential uses in medicinal chemistry and as a ligand in coordination chemistry. Overall, cis-Stilbene-4,4'-dicarboxylic acid is a versatile compound with significant implications in both academic research and industrial applications.
Formula:C16H12O4
InChI:InChI=1/C16H12O4/c17-15(18)13-5-1-3-11(9-13)7-8-12-4-2-6-14(10-12)16(19)20/h1-10H,(H,17,18)(H,19,20)/b8-7-
SMILES:c1cc(/C=C\c2cccc(c2)C(=O)O)cc(c1)C(=O)O
Synonyms:- 3,3'-(Z)-ethene-1,2-diyldibenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4,4'-cis-Stilbenedicarboxylic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C16H12O4Purity:95%Color and Shape:White to cream to yellow, Powder or granular powder or flakesMolecular weight:268.274-[(1Z)-2-(4-carboxyphenyl)ethenyl]benzoic acid
CAS:Formula:C16H12O4Purity:95%Molecular weight:268.2641

