CymitQuimica logo

CAS 13301-33-2

:

5-Amino-4-hydroxy-3-[2-(2-hydroxy-5-nitrophenyl)diazenyl]-2,7-naphthalenedisulfonic acid

Description:
5-Amino-4-hydroxy-3-[2-(2-hydroxy-5-nitrophenyl)diazenyl]-2,7-naphthalenedisulfonic acid, with CAS number 13301-33-2, is a synthetic organic compound characterized by its complex structure, which includes a naphthalene backbone with multiple functional groups. This compound features amino, hydroxy, and sulfonic acid groups, contributing to its solubility in water and potential applications in dye chemistry and as a pH indicator. The presence of the diazenyl group indicates that it may exhibit azo dye properties, which are often associated with vibrant colors and stability under various conditions. Additionally, the nitrophenyl moiety suggests that it may have electron-withdrawing characteristics, influencing its reactivity and interaction with other chemical species. This compound is typically used in research and industrial applications, particularly in the fields of analytical chemistry and materials science, due to its ability to form colored complexes and its potential role in biological systems. Safety and handling precautions are essential, as with many azo compounds, due to potential toxicity and environmental concerns.
Formula:C16H12N4O10S2
InChI:InChI=1S/C16H12N4O10S2/c17-10-6-9(31(25,26)27)3-7-4-13(32(28,29)30)15(16(22)14(7)10)19-18-11-5-8(20(23)24)1-2-12(11)21/h1-6,21-22H,17H2,(H,25,26,27)(H,28,29,30)
InChI key:InChIKey=ZZDLYKYIGJOAOW-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(S(=O)(=O)O)C1N=NC3=CC(N(=O)=O)=CC=C3O)C=C(S(=O)(=O)O)C=C2N
Synonyms:
  • 2,7-Naphthalenedisulfonic acid, 5-amino-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)azo]-
  • C.I. Mordant Green 17
  • 5-Amino-4-hydroxy-3-[2-(2-hydroxy-5-nitrophenyl)diazenyl]-2,7-naphthalenedisulfonic acid
  • 2,7-Naphthalenedisulfonic acid, 5-amino-4-hydroxy-3-[2-(2-hydroxy-5-nitrophenyl)diazenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.