CAS 13301-35-4

1,3,5-Triazine-2-acetonitrile,4,6-diamino-(9CI)

Description:

1,3,5-Triazine-2-acetonitrile, 4,6-diamino- (9CI), with the CAS number 13301-35-4, is a heterocyclic organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features an acetonitrile group and two amino groups at the 4 and 6 positions of the triazine ring, contributing to its reactivity and potential applications in various chemical processes. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino groups. The compound is of interest in fields such as agrochemicals and pharmaceuticals, where it may serve as an intermediate or a building block for more complex molecules. Its properties, including melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₅H₆N₆

InChI: InChI=1/C5H6N6/c6-2-1-3-9-4(7)11-5(8)10-3/h1H2,(H4,7,8,9,10,11)

SMILES: C(C#N)c1nc(=N)[nH]c(=N)[nH]1

Synonyms:

• (4,6-Diamino-1,3,5-Triazin-2-Yl)Acetonitrile

2-(Diamino-1,3,5-triazin-2-yl)acetonitrile

CAS: 13301-35-4

Versatile small molecule scaffold

Formula: C₅H₆N₆

Purity: Min. 95%

Molecular weight: 150.14 g/mol

Ref: 3D-NAA30135