CAS 13302-00-6
:(2-Ethylhexanoato-κO)phenylmercury
Description:
(2-Ethylhexanoato-κO)phenylmercury, with the CAS number 13302-00-6, is an organomercury compound characterized by the presence of a phenyl group bonded to a mercury atom, which is further coordinated to an ethylhexanoate ligand. This compound typically exhibits a white to pale yellow solid appearance and is known for its applications in various fields, including as a biocide and fungicide in agricultural practices. Its structure allows for the formation of coordination complexes, which can influence its reactivity and solubility in organic solvents. The presence of mercury in its composition raises concerns regarding toxicity and environmental impact, necessitating careful handling and disposal. Additionally, the compound may exhibit antimicrobial properties, making it useful in preserving materials. However, due to the potential health risks associated with mercury exposure, its use is regulated in many jurisdictions. Overall, (2-Ethylhexanoato-κO)phenylmercury serves as an example of how organometallic compounds can be utilized in practical applications while also highlighting the importance of safety and environmental considerations.
Formula:C14H20HgO2
InChI:InChI=1S/C8H16O2.C6H5.Hg/c1-3-5-6-7(4-2)8(9)10;1-2-4-6-5-3-1;/h7H,3-6H2,1-2H3,(H,9,10);1-5H;/q;;+1/p-1
InChI key:InChIKey=XVASSELVJHUACE-UHFFFAOYSA-M
SMILES:[Hg](OC(C(CCCC)CC)=O)C1=CC=CC=C1
Synonyms:- (2-Ethylhexanoato-κO)phenylmercury
- 2-Ethylhexanoic Acid - Phenylmercury (1:1)
- Caswell No. 657A
- EPA Pesticide Chemical Code 066024
- Mercury, (2-ethylhexanoato)phenyl-
- Mercury, (2-ethylhexanoato-O)phenyl-
- Mercury, (2-ethylhexanoato-kappaO)phenyl-
- Mercury, (2-ethylhexanoato-κO)phenyl-
- Mercury, [(2-ethylhexanoyl)oxy]phenyl-
- Phenylmercuric 2-ethylhexanoate
- Phenylmercury 2-ethylhexanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phenylmercury 2-Ethylhexanoate
CAS:Controlled ProductApplications Phenylmercury 2-Ethylhexanoate is used as bactericide and fungicide for paint.
References Giesen, M., F.A.T.I.P.E.C. Congr., 8, 185-96 (1966)Formula:C14H20HgO2Color and Shape:NeatMolecular weight:420.897
