CAS 13302-06-2

tributylstannanyl - methanesulfonic acid (1:1)

Description:

Tributylstannanyl-methanesulfonic acid (1:1), with the CAS number 13302-06-2, is a chemical compound that features a tributylstannyl group attached to a methanesulfonic acid moiety. This compound is characterized by its organotin structure, which includes a tin atom bonded to three butyl groups and one methanesulfonic acid group. Organotin compounds are known for their diverse applications, particularly in catalysis and as intermediates in organic synthesis. The presence of the methanesulfonic acid component imparts acidic properties, making it useful in various chemical reactions, including esterification and as a catalyst in polymerization processes. Additionally, tributylstannanyl-methanesulfonic acid may exhibit unique solubility characteristics due to the hydrophobic butyl groups and the hydrophilic sulfonic acid group, influencing its behavior in different solvents. Safety considerations are important when handling this compound, as organotin compounds can be toxic and may pose environmental risks. Proper precautions should be taken to minimize exposure and ensure safe usage in laboratory and industrial settings.

Formula: C₁₃H₃₁O₃SSn

InChI: InChI=1/3C4H9.CH4O3S.Sn/c3*1-3-4-2;1-5(2,3)4;/h3*1,3-4H2,2H3;1H3,(H,2,3,4);/rC12H27Sn.CH4O3S/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-5(2,3)4/h4-12H2,1-3H3;1H3,(H,2,3,4)

SMILES: CCCC[Sn](CCCC)CCCC.CS(=O)(=O)O

Methanesulfonic acid, tributylstannyl ester

CAS: 13302-06-2

Formula: C₁₃H₃₀O₃SSn

Molecular weight: 385.1415

Ref: IN-DA0011JG

tributylstannyl methanesulfonate

Controlled Product

CAS: 13302-06-2

Isocyanates are organic compounds that contain the functional group CN. These compounds react with alcohols, amines, and thiols to form adducts that are called isocyanates. Isocyanates can be classified as aliphatic or aromatic depending on their structure. Tributylstannyl methanesulfonate is a triarylmethane-based aliphatic isocyanate that reacts with alcohols, amines, and thiols to form adducts. It is compatible with polyols and has good storage stability.

Formula: C₁₃H₃₀O₃SSn

Purity: Min. 95%

Molecular weight: 385.15 g/mol

Ref: 3D-FT154511