CAS 13302-67-5
:1,2,4-Naphthalenetriol
Description:
1,2,4-Naphthalenetriol, with the CAS number 13302-67-5, is an organic compound characterized by the presence of three hydroxyl (-OH) groups attached to a naphthalene ring system. This compound exhibits a polyhydroxylated structure, which contributes to its potential solubility in polar solvents and its reactivity in various chemical reactions. The hydroxyl groups can participate in hydrogen bonding, influencing its physical properties such as melting and boiling points. 1,2,4-Naphthalenetriol is often studied for its biological activities, including potential antioxidant properties, and may have applications in pharmaceuticals and materials science. Its chemical behavior can be affected by the positioning of the hydroxyl groups, which can influence its acidity and reactivity with other chemical species. As with many polyhydroxy compounds, it may also exhibit unique interactions with biological systems, making it of interest in medicinal chemistry and biochemistry. Proper handling and safety measures should be observed due to its chemical nature and potential biological effects.
Formula:C10H8O3
InChI:InChI=1S/C10H8O3/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,11-13H
InChI key:InChIKey=ZRJPJJSLXARURS-UHFFFAOYSA-N
SMILES:OC=1C2=C(C(O)=CC1O)C=CC=C2
Synonyms:- 2-Hydroxy-1,4-naphthohydroquinone
- 1,2,4-Naphthalenetriol
- 2-Hydroxy-1,4-naphthoquinol
- 1,2,4-Trihydroxynaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
