CAS 133025-23-7
:N-(1,1-Dimethylethyl)-4-(2-methoxyphenyl)-α-phenyl-1-piperazinepropanamide
Description:
N-(1,1-Dimethylethyl)-4-(2-methoxyphenyl)-α-phenyl-1-piperazinepropanamide, with the CAS number 133025-23-7, is a synthetic organic compound characterized by its complex structure, which includes a piperazine ring and various aromatic substituents. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential bioactivity due to its piperazine moiety, which is often found in pharmacologically active compounds. The presence of the 2-methoxyphenyl group may contribute to its lipophilicity and influence its interaction with biological targets. Additionally, the tert-butyl group (1,1-dimethylethyl) can enhance the steric bulk around the nitrogen atom, potentially affecting the compound's pharmacokinetics and receptor binding affinity. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing agents with specific therapeutic effects. However, detailed studies would be necessary to fully elucidate its biological activity and safety profile.
Formula:C24H33N3O2
InChI:InChI=1S/C24H33N3O2/c1-24(2,3)25-23(28)20(19-10-6-5-7-11-19)18-26-14-16-27(17-15-26)21-12-8-9-13-22(21)29-4/h5-13,20H,14-18H2,1-4H3,(H,25,28)
InChI key:InChIKey=UMTDAKAAYOXIKU-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)N2CCN(CC(C(NC(C)(C)C)=O)C3=CC=CC=C3)CC2
Synonyms:- (S)-Way 100135
- (S)-Way1001352
- 1-Piperazinepropanamide, N-(1,1-dimethylethyl)-4-(2-methoxyphenyl)-α-phenyl-
- N-(1,1-Dimethylethyl)-4-(2-methoxyphenyl)-α-phenyl-1-piperazinepropanamide
- N-tert-butyl-3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-phenylpropanamide
- Way 100135
- Way 100478
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Way 100135
CAS:WAY-100135: research drug, phenylpiperazine, potent 5-HT1A antagonist, partial 5-HT1D agonist, minor 5-HT1B activity.Formula:C24H33N3O2Color and Shape:SolidMolecular weight:395.54
