CAS 1330286-48-0

<span class="text-smallcaps">D</span>-Valine, 3-[[(acetylamino)methyl]thio]-, hydrochloride (1:1)

Description:

D-Valine, 3-[[acetylamino)methyl]thio]-, hydrochloride (1:1) is a synthetic derivative of the amino acid valine, characterized by the presence of an acetylamino group and a thioether linkage. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in aqueous solutions, making it suitable for various biochemical applications. The structure features a branched-chain amino acid, which is essential for protein synthesis and metabolic processes. D-Valine is known for its role in promoting muscle growth and recovery, often utilized in nutritional supplements. Its unique thioether functionality may impart specific biochemical properties, potentially influencing its interaction with enzymes or receptors. As with many amino acid derivatives, it is important to consider its stereochemistry, as the D-configuration can exhibit different biological activities compared to its L-counterpart. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.

Formula: C₈H₁₆N₂O₃S.ClH

InChI: InChI=1S/C8H16N2O3S.ClH/c1-5(11)10-4-14-8(2,3)6(9)7(12)13;/h6H,4,9H2,1-3H3,(H,10,11)(H,12,13);1H/t6-;/m0./s1

InChI key: InChIKey=HMNWKDNSRCKPAN-RGMNGODLSA-N

SMILES: C([C@H](C(O)=O)N)(SCNC(C)=O)(C)C.Cl