CAS 1330286-49-1

L-Norleucine, 5-methyl-, hydrochloride (1:1)

Description:

L-Norleucine, 5-methyl-, hydrochloride (1:1) is an amino acid derivative characterized by its structural similarity to standard amino acids, with a specific focus on its side chain modifications. This compound features a 5-methyl group on the norleucine backbone, which contributes to its unique properties and potential biological activities. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various biochemical applications. The presence of the hydrochloride form indicates that it can exist as a stable crystalline solid, making it easier to handle and store. L-Norleucine is often studied for its role in protein synthesis and its potential effects on metabolic pathways. Its structural characteristics may influence its interaction with enzymes and receptors, making it of interest in pharmacological research. Additionally, like other amino acids, it may participate in various biochemical reactions, contributing to its relevance in both research and potential therapeutic applications.

Formula: C₇H₁₅NO₂·ClH

InChI: InChI=1S/C7H15NO2.ClH/c1-5(2)3-4-6(8)7(9)10;/h5-6H,3-4,8H2,1-2H3,(H,9,10);1H/t6-;/m0./s1

InChI key: InChIKey=FQKANUHWZITUKA-RGMNGODLSA-N

SMILES: [C@H](CCC(C)C)(C(O)=O)N.Cl

Synonyms:

• (2S)-2-Amino-5-methylhexanoic acid hydrochloride
• L-Norleucine, 5-methyl-, hydrochloride (1:1)

H-HoLeu-OH HCl

CAS: 1330286-49-1

Formula: C₇H₁₆ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 181.6604

Ref: IN-DA00HSQ9

H-HoLeu-OH (hydrochloride)

CAS: 1330286-49-1

H-HoLeu-OH (hydrochloride)

Purity: 97%

Ref: 54-OR1039330

L-Homoleucine hydrochloride

CAS: 1330286-49-1

L-Homoleucine hydrochloride is a fine chemical that is used as a building block in the synthesis of complex compounds and pharmaceuticals. It has been shown to be a useful reagent in organic chemistry and can be used as a speciality chemical. L-Homoleucine hydrochloride is also a versatile building block that can be used in the synthesis of several different compounds, including pharmaceuticals, agrochemicals, and research chemicals. This compound is also an intermediate for the production of other compounds with potential clinical applications. L-Homoleucine hydrochloride belongs to CAS number 1330286-49-1.

Formula: C₇H₁₅NO₂·HCl

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 181.66 g/mol

Ref: 3D-FH49102

(S)-2-Amino-5-methylhexanoic acid hydrochloride

CAS: 1330286-49-1

Formula: C₇H₁₆ClNO₂

Purity: 97%

Molecular weight: 181.66

Ref: 10-F464384