CAS 133034-00-1
:1-(P-TOSYL)-(R)-(-)-3-PYRROLIDINOL 98
Description:
1-(P-Tosyl)-(R)-(-)-3-Pyrrolidinol is a chiral compound characterized by the presence of a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The "P-Tosyl" group indicates the presence of a tosyl (p-toluenesulfonyl) moiety, which enhances the compound's reactivity and solubility in organic solvents. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and biologically active molecules due to its chiral nature, which allows for the synthesis of enantiomerically pure products. The "R" configuration denotes that it is one specific enantiomer of the compound, which can exhibit distinct biological activities compared to its counterpart. The compound is often handled with care due to its potential reactivity and the presence of the tosyl group, which can participate in nucleophilic substitution reactions. Overall, 1-(P-Tosyl)-(R)-(-)-3-Pyrrolidinol is valued in synthetic organic chemistry for its utility in creating complex molecular architectures.
Formula:C11H15NO3S
InChI:InChI=1/C11H15NO3S/c1-9-2-4-11(5-3-9)16(14,15)12-7-6-10(13)8-12/h2-5,10,13H,6-8H2,1H3/t10-/m1/s1
SMILES:Cc1ccc(cc1)S(=O)(=O)N1CC[C@H](C1)O
Synonyms:- 133034-00-1
- (3R)-1-[(4-methylphenyl)sulfonyl]pyrrolidin-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
(3R)-1-[(4-Methylphenyl)sulfonyl]tetrahydro-1h-pyrrol-3-ol
CAS:Formula:C11H15NO3SColor and Shape:SolidMolecular weight:241.3067(3R)-1-[(4-Methylphenyl)sulfonyl]-3-pyrrolidinol
CAS:Controlled Product<p>Applications (3R)-1-[(4-Methylphenyl)sulfonyl]-3-pyrrolidinol is a useful building block in organic synthesis.<br>References Rodriguez-Lucena, David, et al.: Let. in Org. Chem., 8(3), 155-162 (2011);Yang, Chu-Ting, et al.: RSC Advances, 7(40), 24652-24656 (2017)<br></p>Formula:C11H15NO3SColor and Shape:NeatMolecular weight:241.307



