CymitQuimica logo

CAS 133034-03-4

:

{1-[(4-methylphenyl)sulfonyl]pyrrolidin-3-yl}(diphenyl)acetonitrile

Description:
The chemical substance known as {1-[(4-methylphenyl)sulfonyl]pyrrolidin-3-yl}(diphenyl)acetonitrile, with the CAS number 133034-03-4, is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring, a sulfonyl group, and a nitrile functional group. This compound typically exhibits properties associated with both polar and nonpolar characteristics due to the presence of multiple functional groups. It is likely to be soluble in organic solvents while having limited solubility in water. The sulfonyl group contributes to its potential reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the diphenyl and methylphenyl moieties may enhance its lipophilicity, influencing its biological activity and interaction with other molecules. Such compounds are often investigated for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C25H24N2O2S
InChI:InChI=1/C25H24N2O2S/c1-20-12-14-24(15-13-20)30(28,29)27-17-16-23(18-27)25(19-26,21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,23H,16-18H2,1H3
SMILES:Cc1ccc(cc1)S(=O)(=O)N1CCC(C1)C(C#N)(c1ccccc1)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.