CymitQuimica logo

CAS 133040-03-6

:

Methyl 4-[(2-butyl-5-formyl-1H-imidazol-1-yl) methyl] benzoate

Description:
Methyl 4-[(2-butyl-5-formyl-1H-imidazol-1-yl)methyl]benzoate, identified by its CAS number 133040-03-6, is a chemical compound that features a complex structure combining both an imidazole ring and a benzoate moiety. This substance typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents due to its hydrophobic aromatic components, while its solubility in water may be limited. The presence of the imidazole ring suggests potential biological activity, as imidazole derivatives are often involved in various biochemical processes. Additionally, the compound may exhibit moderate to high stability under standard conditions, although it could be sensitive to strong acids or bases. Its unique structure may also confer specific reactivity patterns, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals. As with any chemical, proper handling and safety precautions should be observed.
Formula:C17H20N2O3
InChI:InChI=1S/C17H20N2O3/c1-3-4-5-16-18-10-15(12-20)19(16)11-13-6-8-14(9-7-13)17(21)22-2/h6-10,12H,3-5,11H2,1-2H3
SMILES:CCCCc1ncc(C=O)n1Cc1ccc(cc1)C(=O)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.