CAS 133046-46-5
:4-Thiazolecarboxylicacid,2-(trifluoromethyl)-,ethylester(9CI)
Description:
4-Thiazolecarboxylic acid, 2-(trifluoromethyl)-, ethyl ester, also known by its CAS number 133046-46-5, is an organic compound characterized by the presence of a thiazole ring, a carboxylic acid functional group, and an ethyl ester moiety. The trifluoromethyl group attached to the thiazole ring significantly influences its chemical properties, enhancing lipophilicity and potentially altering its reactivity and biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications, including pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group can also impart unique electronic properties, making it a valuable building block in medicinal chemistry. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit toxicity or environmental concerns. Overall, this compound is of interest for its potential applications in synthetic chemistry and drug development.
Formula:C7H6F3NO2S
InChI:InChI=1/C7H6F3NO2S/c1-2-13-5(12)4-3-14-6(11-4)7(8,9)10/h3H,2H2,1H3
SMILES:CCOC(=O)c1csc(C(F)(F)F)n1
Synonyms:- Ethyl 2-(Trifluoromethyl)-1,3-Thiazole-4-Carboxylate
- 2-TrifluoroMethyl-thiazole-4-carboxylic acid ethyl ester
- 4-Thiazolecarboxylicacid,2-(trifluoroMethyl)-,ethylester
- 4-Thiazolecarboxylicacid,2-(trifluoromethyl)-,ethylester(9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 2-(trifluoromethyl)thiazole-4-carboxylate
CAS:Formula:C7H6F3NO2SPurity:97%Color and Shape:SolidMolecular weight:225.194-Thiazolecarboxylic acid, 2-(trifluoromethyl)-, ethyl ester
CAS:Formula:C7H6F3NO2SPurity:97%Color and Shape:SolidMolecular weight:225.1882Ethyl 2-(trifluoromethyl)thiazole-4-carboxylate
CAS:<p>Ethyl 2-(trifluoromethyl)thiazole-4-carboxylate</p>Purity:95%Molecular weight:225.19g/molEthyl 2-(Trifluoromethyl)-1,3-Thiazole-4-Carboxylate
CAS:<p>Please enquire for more information about Ethyl 2-(Trifluoromethyl)-1,3-Thiazole-4-Carboxylate including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C7H6F3NO2SPurity:Min. 95%Molecular weight:225.19 g/mol



