CAS 1330583-62-4
:Ethyl 6-bromo-2-chloro-1,8-naphthyridine-3-carboxylate
Description:
Ethyl 6-bromo-2-chloro-1,8-naphthyridine-3-carboxylate is a chemical compound characterized by its complex structure, which includes a naphthyridine core substituted with bromine and chlorine atoms, as well as an ethyl ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of halogen substituents, which can influence its reactivity and interaction with biological targets. The ethyl ester group suggests that it may be soluble in organic solvents and could participate in esterification or hydrolysis reactions. Additionally, the presence of the carboxylate moiety indicates potential for further chemical modifications, making it a versatile intermediate in synthetic organic chemistry. Its specific applications may vary, but compounds of this type are often explored in medicinal chemistry for their potential pharmacological properties. Safety data and handling precautions should be considered, as halogenated compounds can pose environmental and health risks.
Formula:C11H8BrClN2O2
InChI:InChI=1S/C11H8BrClN2O2/c1-2-17-11(16)8-4-6-3-7(12)5-14-10(6)15-9(8)13/h3-5H,2H2,1H3
InChI key:InChIKey=YBJKOMHKVBMRIF-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC2=C(N=C1Cl)N=CC(Br)=C2
Synonyms:- 1,8-Naphthyridine-3-carboxylic acid, 6-bromo-2-chloro-, ethyl ester
- Ethyl 6-bromo-2-chloro-1,8-naphthyridine-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.