CAS 1330583-63-5

Ethyl 2-chloro-6-iodo-1,8-naphthyridine-3-carboxylate

Description:

Ethyl 2-chloro-6-iodo-1,8-naphthyridine-3-carboxylate is a chemical compound characterized by its complex structure, which includes a naphthyridine core, a carboxylate functional group, and halogen substituents. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as moderate to high stability and potential for various chemical reactivity due to the presence of the chlorine and iodine atoms. The ethyl ester group contributes to its solubility in organic solvents, making it useful in synthetic applications. Additionally, the presence of halogens can enhance its biological activity, potentially making it relevant in pharmaceutical research. The compound may also display specific spectral characteristics in techniques like NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, its unique structural features suggest potential applications in medicinal chemistry and material science, although specific reactivity and biological activity would require further investigation.

Formula: C₁₁H₈ClIN₂O₂

InChI: InChI=1S/C11H8ClIN2O2/c1-2-17-11(16)8-4-6-3-7(13)5-14-10(6)15-9(8)12/h3-5H,2H2,1H3

InChI key: InChIKey=IQXOYMQNYAFMDN-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC2=C(N=C1Cl)N=CC(I)=C2

Synonyms:

• Ethyl 2-chloro-6-iodo-1,8-naphthyridine-3-carboxylate
• 1,8-Naphthyridine-3-carboxylic acid, 2-chloro-6-iodo-, ethyl ester