CAS 1330583-64-6

Ethyl 6-chloro-1,2-dihydro-2-oxo-1,8-naphthyridine-3-carboxylate

Description:

Ethyl 6-chloro-1,2-dihydro-2-oxo-1,8-naphthyridine-3-carboxylate is a chemical compound characterized by its naphthyridine core, which features a chloro substituent and an ester functional group. This compound typically exhibits a pale yellow to off-white solid appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but may have limited solubility in water. The presence of the carboxylate group suggests potential for reactivity in various chemical reactions, including esterification and nucleophilic substitution. Its structure indicates that it may possess biological activity, making it of interest in medicinal chemistry and drug development. The compound's molecular framework allows for potential interactions with biological targets, which could lead to pharmacological applications. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its potential toxicity and environmental impact. Overall, Ethyl 6-chloro-1,2-dihydro-2-oxo-1,8-naphthyridine-3-carboxylate represents a versatile compound with potential applications in various fields of chemistry and biology.

Formula: C₁₁H₉ClN₂O₃

InChI: InChI=1S/C11H9ClN2O3/c1-2-17-11(16)8-4-6-3-7(12)5-13-9(6)14-10(8)15/h3-5H,2H2,1H3,(H,13,14,15)

InChI key: InChIKey=QKKHFLOAHTUJBV-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC=2C(=NC1=O)NC=C(Cl)C2

Synonyms:

• 1,8-Naphthyridine-3-carboxylic acid, 6-chloro-1,2-dihydro-2-oxo-, ethyl ester
• Ethyl 6-chloro-1,2-dihydro-2-oxo-1,8-naphthyridine-3-carboxylate