CAS 1330583-68-0

4-[[(4-Fluorophenyl)amino]methyl]-4-piperidinol

Description:

4-[[(4-Fluorophenyl)amino]methyl]-4-piperidinol is a chemical compound characterized by its piperidine structure, which includes a fluorophenyl group and an amino methyl substituent. This compound typically exhibits properties associated with piperidine derivatives, such as potential solubility in polar solvents and moderate lipophilicity due to the presence of the fluorophenyl moiety. The fluorine atom can influence the compound's electronic properties, potentially enhancing its biological activity or altering its pharmacokinetic profile. The amino group contributes to the basicity of the molecule, which may affect its interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could facilitate interactions with various biological receptors or enzymes. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other chemical species. Safety and handling precautions should be observed, as with any chemical substance.

Formula: C₁₂H₁₇FN₂O

InChI: InChI=1S/C12H17FN2O/c13-10-1-3-11(4-2-10)15-9-12(16)5-7-14-8-6-12/h1-4,14-16H,5-9H2

InChI key: InChIKey=WRXBMRKWIWQHRW-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(F)C=C1)C2(O)CCNCC2

Synonyms:

• 4-Piperidinol, 4-[[(4-fluorophenyl)amino]methyl]-
• 4-[[(4-Fluorophenyl)amino]methyl]-4-piperidinol