CAS 1330583-69-1

2,6-Dichloro-1,8-naphthyridine-3-carbonitrile

Description:

2,6-Dichloro-1,8-naphthyridine-3-carbonitrile is a heterocyclic organic compound characterized by its naphthyridine core, which features two chlorine substituents at the 2 and 6 positions and a cyano group at the 3 position. This compound is typically a solid at room temperature and exhibits a crystalline structure. It is known for its potential applications in medicinal chemistry, particularly as a scaffold for developing pharmaceuticals due to its ability to interact with biological targets. The presence of chlorine atoms enhances its lipophilicity, which can influence its bioavailability and pharmacokinetic properties. Additionally, the cyano group contributes to its reactivity and can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, 2,6-Dichloro-1,8-naphthyridine-3-carbonitrile is a compound of interest in both research and industrial applications.

Formula: C₉H₃Cl₂N₃

InChI: InChI=1S/C9H3Cl2N3/c10-7-2-5-1-6(3-12)8(11)14-9(5)13-4-7/h1-2,4H

InChI key: InChIKey=XYYJEGZQLWIEDC-UHFFFAOYSA-N

SMILES: C(#N)C1=CC2=C(N=C1Cl)N=CC(Cl)=C2

Synonyms:

• 1,8-Naphthyridine-3-carbonitrile, 2,6-dichloro-
• 2,6-Dichloro-1,8-naphthyridine-3-carbonitrile