CymitQuimica logo

CAS 133060-80-7

:

N-Ethyl-1,6-dihydro-1,2-dimethyl-6-(methylimino)-N-phenyl-4-pyrimidinamine

Description:
N-Ethyl-1,6-dihydro-1,2-dimethyl-6-(methylimino)-N-phenyl-4-pyrimidinamine, with CAS number 133060-80-7, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of various substituents, including ethyl, methyl, and phenyl groups, contributes to its unique chemical properties and potential biological activity. The compound may exhibit characteristics such as solubility in organic solvents, and its structure suggests potential interactions with biological targets, making it of interest in pharmaceutical research. Additionally, the presence of the methylimino group may influence its reactivity and stability. As with many organic compounds, its behavior in different environments, including pH and temperature variations, can significantly affect its properties. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C15H20N4
InChI:InChI=1S/C15H20N4/c1-5-19(13-9-7-6-8-10-13)15-11-14(16-3)18(4)12(2)17-15/h6-11H,5H2,1-4H3
InChI key:InChIKey=JABSKGQQWUDVRU-UHFFFAOYSA-N
SMILES:N(CC)(C1=CC(=NC)N(C)C(C)=N1)C2=CC=CC=C2
Synonyms:
  • 4-Pyrimidinamine, N-ethyl-1,6-dihydro-1,2-dimethyl-6-(methylimino)-N-phenyl-
  • N-Ethyl-1,6-dihydro-1,2-dimethyl-6-(methylimino)-N-phenyl-4-pyrimidinamine
  • Zd 7288
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.