CymitQuimica logo

CAS 1330632-46-6

:

4-(2-Methylpropoxy)-1,3-benzenedicarbothioamide

Description:
4-(2-Methylpropoxy)-1,3-benzenedicarbothioamide, identified by its CAS number 1330632-46-6, is an organic compound characterized by its unique structural features. It contains a benzene ring substituted with two functional groups: a dicarbothioamide moiety and a 2-methylpropoxy group. The presence of the dicarbothioamide functional group suggests that the compound may exhibit properties typical of thioureas, such as potential biological activity and the ability to form hydrogen bonds. The 2-methylpropoxy group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with other molecules. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential reactivity and ability to participate in diverse chemical reactions. Additionally, the specific arrangement of atoms and functional groups can affect its physical properties, such as melting point, boiling point, and stability under different conditions. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H16N2OS2
InChI:InChI=1S/C12H16N2OS2/c1-7(2)6-15-10-4-3-8(11(13)16)5-9(10)12(14)17/h3-5,7H,6H2,1-2H3,(H2,13,16)(H2,14,17)
InChI key:InChIKey=LPSLBTBUAGKOJQ-UHFFFAOYSA-N
SMILES:C(N)(=S)C1=C(OCC(C)C)C=CC(C(N)=S)=C1
Synonyms:
  • 4-(2-Methylpropoxy)-1,3-benzenedicarbothioamide
  • 1,3-Benzenedicarbothioamide, 4-(2-methylpropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.