CAS 133066-70-3
:N-methylbenperidol
Description:
N-methylbenperidol is a chemical compound that belongs to the class of butyrophenones, which are primarily known for their antipsychotic properties. It is characterized by its structural features, including a methyl group attached to the nitrogen atom of the piperidine ring, which influences its pharmacological activity. The compound exhibits a high affinity for dopamine receptors, particularly D2 receptors, making it relevant in the treatment of various psychiatric disorders. N-methylbenperidol is typically administered in a clinical setting and is noted for its potential side effects, which may include extrapyramidal symptoms due to its dopaminergic activity. Additionally, it is important to consider its solubility, stability, and metabolic pathways when evaluating its therapeutic use and safety profile. As with many pharmaceuticals, the specific characteristics such as melting point, boiling point, and solubility can vary based on formulation and purity. Overall, N-methylbenperidol represents a significant compound in the realm of neuropharmacology, contributing to the understanding and management of mental health conditions.
Formula:C23H26FN3O2
InChI:InChI=1/C23H26FN3O2/c1-25-20-5-2-3-6-21(20)27(23(25)29)19-12-15-26(16-13-19)14-4-7-22(28)17-8-10-18(24)11-9-17/h2-3,5-6,8-11,19H,4,7,12-16H2,1H3
SMILES:Cn1c2ccccc2n(C2CCN(CCCC(=O)c3ccc(cc3)F)CC2)c1=O
Synonyms:- 1-(1-(4-(4-Fluorophenyl)-4-oxobutyl)-4-piperidinyl)-1,3-dihydro-3-(methyl-11C)-2H-benzimidazol-2-one
- N-(11C)Methyl-benperidol
- 2H-Benzimidazol-2-one, 1-(1-(4-(4-fluorophenyl)-4-oxobutyl)-4-piperidinyl)-1,3-dihydro-3-(methyl-11C)-
- 1-{1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl}-3-methyl-1,3-dihydro-2H-benzimidazol-2-one
- N-Methylbenperidol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-[1-[4-(4-Fluorophenyl)-4-Oxobutyl]Piperidin-4-Yl]-3-Methylbenzimidazol-2-One
CAS:Controlled Product1-[1-[4-(4-Fluorophenyl)-4-Oxobutyl]Piperidin-4-Yl]-3-Methylbenzimidazol-2-One is a novel dopamine agonist that has been shown to be an alerting agent with potential therapeutic use in the treatment of ADHD and other sleep disorders. Studies have also shown that it has a stimulatory effect on dopamine receptors, which are located in the striatum. 1-[1-[4-(4-Fluorophenyl)-4-Oxobutyl]Piperidin-4-Yl]-3-Methylbenzimidazol-2-One binds to both D2 and D3 dopamine receptors with high affinity and selectivity. It has been shown that 1-[1-[4-(4-Fluorophenyl)-4-Oxobutyl]Piperidin-4-Yl]-3-MethylFormula:C23H26FN3O2Purity:Min. 95%Molecular weight:395.47 g/mol
