CAS 13307-05-6
:1-Chloro-N,N,N′,N′,N′′,N′′-hexamethylsilanetriamine
Description:
1-Chloro-N,N,N′,N′,N′′,N′′-hexamethylsilanetriamine, with the CAS number 13307-05-6, is a chemical compound characterized by its silane structure, which includes a silicon atom bonded to multiple methyl groups and nitrogen atoms. This compound features a chloro substituent, which enhances its reactivity and potential applications in various chemical processes. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of multiple methyl groups contributes to its steric bulk, influencing its chemical behavior and interactions. This compound is often utilized in organic synthesis and as a reagent in the preparation of other chemical entities. Its nitrogen atoms can participate in coordination chemistry, making it of interest in the development of catalysts or ligands. Additionally, due to its unique structure, it may exhibit interesting properties such as solubility in organic solvents and potential applications in materials science. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C6H18ClN3Si
InChI:InChI=1S/C6H18ClN3Si/c1-8(2)11(7,9(3)4)10(5)6/h1-6H3
InChI key:InChIKey=YLZCZVGQEADVNK-UHFFFAOYSA-N
SMILES:[Si](N(C)C)(N(C)C)(N(C)C)Cl
Synonyms:- 1-chloro-N,N,N',N',N'',N''-hexamethylsilanetriamine
- Chlorotris(dimethylamino)silane
- Silanetriamine, 1-chloro-N,N,N′,N′,N′′,N′′-hexamethyl-
- Tris(dimethylamino)silyl chloride
- Trisdimethylaminochlorosilane
- [Chlorobis(dimethylamino)silyl]dimethylamine
- Tris(dimethylamino)chlorosilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
