CymitQuimica logo

CAS 13307-34-1

:

α-Methylbicyclo[2.2.1]hept-5-ene-2-methanol

Description:
α-Methylbicyclo[2.2.1]hept-5-ene-2-methanol, with CAS number 13307-34-1, is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a bicyclo[2.2.1]heptane framework with a methyl group and a hydroxymethyl group attached. This compound features a double bond in the bicyclic system, contributing to its reactivity and potential applications in organic synthesis. The presence of the hydroxymethyl group indicates that it can participate in various chemical reactions, such as alcohol-based reactions, making it a valuable intermediate in organic chemistry. Its stereochemistry can influence its physical properties and reactivity, and it may exhibit interesting behavior in terms of solubility and boiling point due to its bicyclic nature. Additionally, the compound may have implications in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research and exploration of its chemical properties. Overall, α-Methylbicyclo[2.2.1]hept-5-ene-2-methanol is a compound of interest due to its structural features and potential utility in various chemical contexts.
Formula:C9H14O
InChI:InChI=1S/C9H14O/c1-6(10)9-5-7-2-3-8(9)4-7/h2-3,6-10H,4-5H2,1H3
InChI key:InChIKey=OVEARCWULHSQDS-UHFFFAOYSA-N
SMILES:C(C)(O)C1C2CC(C1)C=C2
Synonyms:
  • 5-(α-Hydroxyethyl)bicyclo[2.2.1]hept-2-ene
  • 5-Norbornene-2-methanol, α-methyl-
  • 1-(Norborn-5-en-2-yl)-ethanol
  • Bicyclo[2.2.1]hept-5-ene-2-methanol, α-methyl-
  • α-Methylbicyclo[2.2.1]hept-5-ene-2-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.