CAS 1330750-21-4
:5-Bromo-2-(cyclopentylthio)pyrimidine
Description:
5-Bromo-2-(cyclopentylthio)pyrimidine is a heterocyclic organic compound characterized by the presence of a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The compound features a bromine atom at the 5-position and a cyclopentylthio group at the 2-position, contributing to its unique chemical properties. The presence of the bromine substituent enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The cyclopentylthio group introduces a sulfur atom, which can participate in further chemical transformations and may influence the compound's solubility and stability. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other complex molecules. Its specific interactions and applications would depend on the context of its use, including its role in drug development or as a building block in organic synthesis.
Formula:C9H11BrN2S
InChI:InChI=1S/C9H11BrN2S/c10-7-5-11-9(12-6-7)13-8-3-1-2-4-8/h5-6,8H,1-4H2
InChI key:InChIKey=JTKWGTIEYQTMKZ-UHFFFAOYSA-N
SMILES:S(C=1N=CC(Br)=CN1)C2CCCC2
Synonyms:- Pyrimidine, 5-bromo-2-(cyclopentylthio)-
- 5-Bromo-2-(cyclopentylthio)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
