CAS 1330750-23-6

5-Bromo-4-fluoro-2-nitrobenzoic acid

Description:

5-Bromo-4-fluoro-2-nitrobenzoic acid is an aromatic compound characterized by the presence of a benzoic acid moiety substituted with bromine, fluorine, and nitro groups. The molecular structure features a benzene ring with a carboxylic acid functional group (-COOH) and three substituents: a bromine atom at the 5-position, a fluorine atom at the 4-position, and a nitro group (-NO2) at the 2-position. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its unique combination of halogen and nitro substituents can influence its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The presence of these functional groups can also impart specific electronic properties, affecting its behavior in chemical reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₇H₃BrFNO₄

InChI: InChI=1S/C7H3BrFNO4/c8-4-1-3(7(11)12)6(10(13)14)2-5(4)9/h1-2H,(H,11,12)

InChI key: InChIKey=SRAJUIZMZUCXQU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N(=O)=O)C=C(F)C(Br)=C1

Synonyms:

• Benzoic acid, 5-bromo-4-fluoro-2-nitro-
• 5-Bromo-4-fluoro-2-nitrobenzoic acid

5-Bromo-4-fluoro-2-nitrobenzoic acid

CAS: 1330750-23-6

Formula: C₇H₃BrFNO₄

Molecular weight: 264.0054

Ref: IN-DA00146Q

5-Bromo-4-fluoro-2-nitrobenzoic acid

CAS: 1330750-23-6

Formula: C₇H₃BrFNO₄

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 264.006

Ref: 10-F212378