CymitQuimica logo

CAS 1330750-28-1

:

1-Bromo-3-methoxy-5-(trifluoromethoxy)benzene

Description:
1-Bromo-3-methoxy-5-(trifluoromethoxy)benzene is an organic compound characterized by its aromatic structure, which includes a bromine atom, a methoxy group, and a trifluoromethoxy group attached to a benzene ring. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The methoxy group (-OCH3) is an electron-donating substituent, enhancing the electron density on the aromatic ring, while the trifluoromethoxy group (-OCF3) is a strong electron-withdrawing group due to the electronegativity of fluorine atoms, which can significantly affect the compound's chemical behavior and stability. This compound may exhibit properties such as moderate solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals due to its unique functional groups. Additionally, the presence of fluorine can impart unique characteristics such as increased lipophilicity and metabolic stability. Overall, the interplay of these substituents contributes to the compound's potential utility in various chemical applications.
Formula:C8H6BrF3O2
InChI:InChI=1S/C8H6BrF3O2/c1-13-6-2-5(9)3-7(4-6)14-8(10,11)12/h2-4H,1H3
InChI key:InChIKey=XVZXJTCWTLEHQT-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(OC)=CC(Br)=C1
Synonyms:
  • 3-Bromo-5-trifluoromethoxyanisole
  • Benzene, 1-bromo-3-methoxy-5-(trifluoromethoxy)-
  • 1-Bromo-3-methoxy-5-(trifluoromethoxy)benzene
Found 3 products.