CymitQuimica logo

CAS 1330750-29-2

:

Acetamide, N-[1-(4-bromophenyl)cyclopropyl]-

Description:
Acetamide, N-[1-(4-bromophenyl)cyclopropyl]- is an organic compound characterized by its acetamide functional group, which features a carbonyl group (C=O) bonded to a nitrogen atom (N) that is further connected to a cyclopropyl group substituted with a 4-bromophenyl moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents due to the presence of the amide bond, which can engage in hydrogen bonding. The presence of the bromine atom on the phenyl ring can influence the compound's reactivity and polarity, potentially enhancing its biological activity or interaction with other chemical species. The cyclopropyl group may impart unique steric and electronic properties, affecting the compound's overall stability and reactivity. As with many organic compounds, the specific characteristics, including melting point, boiling point, and spectral properties, would depend on the molecular structure and intermolecular interactions. This compound may have applications in medicinal chemistry or materials science, depending on its specific properties and biological activity.
Formula:C11H12BrNO
InChI:InChI=1S/C11H12BrNO/c1-8(14)13-11(6-7-11)9-2-4-10(12)5-3-9/h2-5H,6-7H2,1H3,(H,13,14)
InChI key:InChIKey=UIDHJWBXLYVJEU-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1(CC1)C2=CC=C(Br)C=C2
Synonyms:
  • N-[1-(4-Bromo-phenyl)cyclopropyl]acetamide
  • Acetamide, N-[1-(4-bromophenyl)cyclopropyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.