CAS 1330750-30-5
:Ethyl 6-(2,5-difluorophenyl)-2-pyridinecarboxylate
Description:
Ethyl 6-(2,5-difluorophenyl)-2-pyridinecarboxylate is an organic compound characterized by its pyridine and aromatic fluorinated substituents. It features a pyridine ring, which is a six-membered heterocyclic structure containing one nitrogen atom, and an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of the 2,5-difluorophenyl group introduces significant electronegativity due to the fluorine atoms, which can influence the compound's electronic properties and potential interactions in chemical reactions. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of fluorine can enhance metabolic stability and lipophilicity, which are desirable traits in drug design. Overall, Ethyl 6-(2,5-difluorophenyl)-2-pyridinecarboxylate is a compound of interest due to its unique structural features and potential applications in various fields of chemistry and pharmacology.
Formula:C14H11F2NO2
InChI:InChI=1S/C14H11F2NO2/c1-2-19-14(18)13-5-3-4-12(17-13)10-8-9(15)6-7-11(10)16/h3-8H,2H2,1H3
InChI key:InChIKey=AZYCMTJIXDNJBR-UHFFFAOYSA-N
SMILES:FC1=C(C=2N=C(C(OCC)=O)C=CC2)C=C(F)C=C1
Synonyms:- Ethyl 6-(2,5-difluorophenyl)-2-pyridinecarboxylate
- 2-Pyridinecarboxylic acid, 6-(2,5-difluorophenyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
