CAS 1330750-31-6
:1-(3-Chlorophenyl)cyclopentanecarboxamide
Description:
1-(3-Chlorophenyl)cyclopentanecarboxamide is a chemical compound characterized by its unique structure, which includes a cyclopentane ring and a chlorophenyl group. The presence of the carboxamide functional group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. The chlorophenyl moiety suggests potential for aromatic interactions, while the cyclopentane ring contributes to the compound's three-dimensional conformation. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Additionally, the chlorine substituent can affect the electronic properties of the molecule, potentially influencing its reactivity and interaction with biological targets. Overall, 1-(3-Chlorophenyl)cyclopentanecarboxamide represents a complex organic structure with potential applications in various fields, including drug discovery and materials science.
Formula:C12H14ClNO
InChI:InChI=1S/C12H14ClNO/c13-10-5-3-4-9(8-10)12(11(14)15)6-1-2-7-12/h3-5,8H,1-2,6-7H2,(H2,14,15)
InChI key:InChIKey=BZUPPVHGWMRFOU-UHFFFAOYSA-N
SMILES:C(N)(=O)C1(CCCC1)C2=CC(Cl)=CC=C2
Synonyms:- Cyclopentanecarboxamide, 1-(3-chlorophenyl)-
- 1-(3-Chlorophenyl)cyclopentanecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
