CAS 1330750-34-9
:4-Bromo-N-cyclopropyl-3-(trifluoromethyl)benzenesulfonamide
Description:
4-Bromo-N-cyclopropyl-3-(trifluoromethyl)benzenesulfonamide is a chemical compound characterized by its unique structural features, which include a bromine atom, a cyclopropyl group, and a trifluoromethyl group attached to a benzenesulfonamide moiety. This compound belongs to the class of sulfonamides, which are known for their diverse biological activities, including antibacterial and antitumor properties. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's pharmacokinetic properties. The bromine substituent may also contribute to the compound's reactivity and potential interactions with biological targets. Additionally, the cyclopropyl group can introduce strain and steric effects, which may affect the compound's conformation and overall activity. Overall, 4-Bromo-N-cyclopropyl-3-(trifluoromethyl)benzenesulfonamide is of interest in medicinal chemistry and drug development due to its potential therapeutic applications and unique chemical properties.
Formula:C10H9BrF3NO2S
InChI:InChI=1S/C10H9BrF3NO2S/c11-9-4-3-7(5-8(9)10(12,13)14)18(16,17)15-6-1-2-6/h3-6,15H,1-2H2
InChI key:InChIKey=IJEJCBQLVWQHTO-UHFFFAOYSA-N
SMILES:S(NC1CC1)(=O)(=O)C2=CC(C(F)(F)F)=C(Br)C=C2
Synonyms:- 4-Bromo-N-cyclopropyl-3-(trifluoromethyl)benzenesulfonamide
- Benzenesulfonamide, 4-bromo-N-cyclopropyl-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Bromo-N-cyclopropyl-3-(trifluoromethyl)benzenesulfonamide
CAS:Formula:C10H9BrF3NO2SMolecular weight:344.1482
