CAS 1330750-39-4
:4-Bromo-5-ethoxy-N-(1-methylethyl)-2-nitrobenzenamine
Description:
4-Bromo-5-ethoxy-N-(1-methylethyl)-2-nitrobenzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, an ethoxy group, and a nitro group attached to a benzene ring. The presence of the amino group (-NH2) indicates that it is an aniline derivative, which typically exhibits properties such as being a weak base due to the lone pair of electrons on the nitrogen atom. The ethoxy group contributes to its solubility in organic solvents, while the nitro group can enhance its reactivity, particularly in electrophilic substitution reactions. The compound's bromine substituent can also participate in various chemical reactions, including nucleophilic substitutions. Overall, this compound may exhibit interesting biological activities and could be of interest in pharmaceutical research or synthetic chemistry. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety data should also be consulted due to the potential hazards associated with handling halogenated and nitro compounds.
Formula:C11H15BrN2O3
InChI:InChI=1S/C11H15BrN2O3/c1-4-17-11-6-9(13-7(2)3)10(14(15)16)5-8(11)12/h5-7,13H,4H2,1-3H3
InChI key:InChIKey=OOYVHFHUOZHVFE-UHFFFAOYSA-N
SMILES:N(C(C)C)C1=C(N(=O)=O)C=C(Br)C(OCC)=C1
Synonyms:- Benzenamine, 4-bromo-5-ethoxy-N-(1-methylethyl)-2-nitro-
- 4-Bromo-5-ethoxy-N-(1-methylethyl)-2-nitrobenzenamine
- 4-Bromo-5-ethoxy-N-isopropyl-2-nitroaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
